C16H17F3N2O3 — CID 98132560
(2R,4R)-2-cyano-3-oxo-N-propyl-4-[2-(trifluoromethyl)phenoxy]pentanamide (PubChem CID 98132560) has the molecular formula C16H17F3N2O3 and a molecular weight of 342.32 g/mol. Its IUPAC name is (2R,4R)-2-cyano-3-oxo-N-propyl-4-[2-(trifluoromethyl)phenoxy]pentanamide.
| Compound Name | (2R,4R)-2-cyano-3-oxo-N-propyl-4-[2-(trifluoromethyl)phenoxy]pentanamide |
|---|---|
| PubChem CID | 98132560 |
| Molecular Formula | C16H17F3N2O3 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (2R,4R)-2-cyano-3-oxo-N-propyl-4-[2-(trifluoromethyl)phenoxy]pentanamide |
| SMILES | CCCNC(=O)[C@H](C#N)C(=O)[C@@H](C)Oc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H17F3N2O3/c1-3-8-21-15(23)11(9-20)14(22)10(2)24-13-7-5-4-6-12(13)16(17,18)19/h4-7,10-11H,3,8H2,1-2H3,(H,21,23)/t10-,11-/m1/s1 |
| InChIKey | QNNCAPLTGFUXDS-GHMZBOCLSA-N |
| XLogP | 2.71 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|