C25H28N4O — CID 98133618
(2S)-2-phenyl-N-[[4-(5-pyridin-4-ylpyrimidin-4-yl)cyclohexyl]methyl]propanamide (PubChem CID 98133618) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is (2S)-2-phenyl-N-[[4-(5-pyridin-4-ylpyrimidin-4-yl)cyclohexyl]methyl]propanamide.
| Compound Name | (2S)-2-phenyl-N-[[4-(5-pyridin-4-ylpyrimidin-4-yl)cyclohexyl]methyl]propanamide |
|---|---|
| PubChem CID | 98133618 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (2S)-2-phenyl-N-[[4-(5-pyridin-4-ylpyrimidin-4-yl)cyclohexyl]methyl]propanamide |
| SMILES | C[C@H](C(=O)NCC1CCC(c2ncncc2-c2ccncc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H28N4O/c1-18(20-5-3-2-4-6-20)25(30)28-15-19-7-9-22(10-8-19)24-23(16-27-17-29-24)21-11-13-26-14-12-21/h2-6,11-14,16-19,22H,7-10,15H2,1H3,(H,28,30)/t18-,19?,22?/m0/s1 |
| InChIKey | CCWQLVISIOYEQX-PGFLUOATSA-N |
| XLogP | 4.73 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |