C22H29N3O3 — CID 98135938
N-[(S)-[4-(aminomethyl)cyclohexyl]-pyridin-2-ylmethyl]-2,5-dimethoxybenzamide (PubChem CID 98135938) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-[(S)-[4-(aminomethyl)cyclohexyl]-pyridin-2-ylmethyl]-2,5-dimethoxybenzamide.
| Compound Name | N-[(S)-[4-(aminomethyl)cyclohexyl]-pyridin-2-ylmethyl]-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 98135938 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-[(S)-[4-(aminomethyl)cyclohexyl]-pyridin-2-ylmethyl]-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)N[C@H](c2ccccn2)C2CCC(CN)CC2)c1 |
| InChI | InChI=1S/C22H29N3O3/c1-27-17-10-11-20(28-2)18(13-17)22(26)25-21(19-5-3-4-12-24-19)16-8-6-15(14-23)7-9-16/h3-5,10-13,15-16,21H,6-9,14,23H2,1-2H3,(H,25,26)/t15?,16?,21-/m0/s1 |
| InChIKey | KODOASSLDODLLS-BUNACBEFSA-N |
| XLogP | 3.34 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |