C21H27N5O2 — CID 98136032
N-[[4-[(S)-acetamido(pyridin-2-yl)methyl]cyclohexyl]methyl]-2-aminopyridine-3-carboxamide (PubChem CID 98136032) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[[4-[(S)-acetamido(pyridin-2-yl)methyl]cyclohexyl]methyl]-2-aminopyridine-3-carboxamide.
| Compound Name | N-[[4-[(S)-acetamido(pyridin-2-yl)methyl]cyclohexyl]methyl]-2-aminopyridine-3-carboxamide |
|---|---|
| PubChem CID | 98136032 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-[[4-[(S)-acetamido(pyridin-2-yl)methyl]cyclohexyl]methyl]-2-aminopyridine-3-carboxamide |
| SMILES | CC(=O)N[C@H](c1ccccn1)C1CCC(CNC(=O)c2cccnc2N)CC1 |
| InChI | InChI=1S/C21H27N5O2/c1-14(27)26-19(18-6-2-3-11-23-18)16-9-7-15(8-10-16)13-25-21(28)17-5-4-12-24-20(17)22/h2-6,11-12,15-16,19H,7-10,13H2,1H3,(H2,22,24)(H,25,28)(H,26,27)/t15?,16?,19-/m0/s1 |
| InChIKey | ZXZMPVMUBHHODA-RJYAGPCLSA-N |
| XLogP | 2.47 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |