C23H28FN3O2 — CID 98136163
N-[(S)-[4-(acetamidomethyl)cyclohexyl]-pyridin-2-ylmethyl]-2-(3-fluorophenyl)acetamide (PubChem CID 98136163) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is N-[(S)-[4-(acetamidomethyl)cyclohexyl]-pyridin-2-ylmethyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[(S)-[4-(acetamidomethyl)cyclohexyl]-pyridin-2-ylmethyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 98136163 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-[(S)-[4-(acetamidomethyl)cyclohexyl]-pyridin-2-ylmethyl]-2-(3-fluorophenyl)acetamide |
| SMILES | CC(=O)NCC1CCC([C@H](NC(=O)Cc2cccc(F)c2)c2ccccn2)CC1 |
| InChI | InChI=1S/C23H28FN3O2/c1-16(28)26-15-17-8-10-19(11-9-17)23(21-7-2-3-12-25-21)27-22(29)14-18-5-4-6-20(24)13-18/h2-7,12-13,17,19,23H,8-11,14-15H2,1H3,(H,26,28)(H,27,29)/t17?,19?,23-/m0/s1 |
| InChIKey | KBOXTXOIPPTSKR-WFHLNLCJSA-N |
| XLogP | 3.56 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |