C20H26FN3 — CID 110241888
1-[4-(aminomethyl)cyclohexyl]-N-[(3-fluorophenyl)methyl]-1-pyridin-2-ylmethanamine (PubChem CID 110241888) has the molecular formula C20H26FN3 and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-[4-(aminomethyl)cyclohexyl]-N-[(3-fluorophenyl)methyl]-1-pyridin-2-ylmethanamine.
| Compound Name | 1-[4-(aminomethyl)cyclohexyl]-N-[(3-fluorophenyl)methyl]-1-pyridin-2-ylmethanamine |
|---|---|
| PubChem CID | 110241888 |
| Molecular Formula | C20H26FN3 |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 1-[4-(aminomethyl)cyclohexyl]-N-[(3-fluorophenyl)methyl]-1-pyridin-2-ylmethanamine |
| SMILES | NCC1CCC(C(NCc2cccc(F)c2)c2ccccn2)CC1 |
| InChI | InChI=1S/C20H26FN3/c21-18-5-3-4-16(12-18)14-24-20(19-6-1-2-11-23-19)17-9-7-15(13-22)8-10-17/h1-6,11-12,15,17,20,24H,7-10,13-14,22H2 |
| InChIKey | CNKULNYGOMGBTJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |