C19H23N5O3 — CID 98136623
(3,5-dimethyl-1,2-oxazol-4-yl)-[(1R,9R)-5-morpholin-4-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone (PubChem CID 98136623) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)-[(1R,9R)-5-morpholin-4-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)-[(1R,9R)-5-morpholin-4-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone |
|---|---|
| PubChem CID | 98136623 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)-[(1R,9R)-5-morpholin-4-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone |
| SMILES | Cc1noc(C)c1C(=O)N1[C@@H]2CC[C@@H]1c1cnc(N3CCOCC3)nc1C2 |
| InChI | InChI=1S/C19H23N5O3/c1-11-17(12(2)27-22-11)18(25)24-13-3-4-16(24)14-10-20-19(21-15(14)9-13)23-5-7-26-8-6-23/h10,13,16H,3-9H2,1-2H3/t13-,16-/m1/s1 |
| InChIKey | YXWLIIPQFFNQOL-CZUORRHYSA-N |
| XLogP | 1.82 |
| TPSA | 84.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |