C25H20N2O8 — CID 98140341
[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl] 4-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate (PubChem CID 98140341) has the molecular formula C25H20N2O8 and a molecular weight of 476.44 g/mol. Its IUPAC name is [2-(4-methoxy-3-nitrophenyl)-2-oxoethyl] 4-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate.
| Compound Name | [2-(4-methoxy-3-nitrophenyl)-2-oxoethyl] 4-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
|---|---|
| PubChem CID | 98140341 |
| Molecular Formula | C25H20N2O8 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | [2-(4-methoxy-3-nitrophenyl)-2-oxoethyl] 4-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(N3C(=O)[C@@H]4[C@@H](C3=O)[C@H]3C=C[C@H]4C3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H20N2O8/c1-34-20-9-6-14(11-18(20)27(32)33)19(28)12-35-25(31)13-4-7-17(8-5-13)26-23(29)21-15-2-3-16(10-15)22(21)24(26)30/h2-9,11,15-16,21-22H,10,12H2,1H3/t15-,16-,21-,22-/m0/s1 |
| InChIKey | TUZHXGZUHAHIOI-QDGJQWLKSA-N |
| XLogP | 2.95 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|