C31H22N2O9 — CID 98319698
[2-[2-(4-nitrobenzoyl)oxyphenyl]-2-oxoethyl] 4-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate (PubChem CID 98319698) has the molecular formula C31H22N2O9 and a molecular weight of 566.52 g/mol. Its IUPAC name is [2-[2-(4-nitrobenzoyl)oxyphenyl]-2-oxoethyl] 4-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate.
| Compound Name | [2-[2-(4-nitrobenzoyl)oxyphenyl]-2-oxoethyl] 4-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
|---|---|
| PubChem CID | 98319698 |
| Molecular Formula | C31H22N2O9 |
| Molecular Weight | 566.52 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | [2-[2-(4-nitrobenzoyl)oxyphenyl]-2-oxoethyl] 4-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
| SMILES | O=C(OCC(=O)c1ccccc1OC(=O)c1ccc([N+](=O)[O-])cc1)c1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)cc1 |
| InChI | InChI=1S/C31H22N2O9/c34-24(23-3-1-2-4-25(23)42-31(38)18-9-13-22(14-10-18)33(39)40)16-41-30(37)17-7-11-21(12-8-17)32-28(35)26-19-5-6-20(15-19)27(26)29(32)36/h1-14,19-20,26-27H,15-16H2/t19-,20-,26-,27+/m0/s1 |
| InChIKey | JPUGPPNVVZBAHA-LQBPYSJUSA-N |
| XLogP | 4.17 |
| TPSA | 150.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|