C23H19NO6 — CID 98151021
(5-methyl-2-oxochromen-7-yl) 2-[(1R,2S,6R,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetate (PubChem CID 98151021) has the molecular formula C23H19NO6 and a molecular weight of 405.41 g/mol. Its IUPAC name is (5-methyl-2-oxochromen-7-yl) 2-[(1R,2S,6R,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetate.
| Compound Name | (5-methyl-2-oxochromen-7-yl) 2-[(1R,2S,6R,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetate |
|---|---|
| PubChem CID | 98151021 |
| Molecular Formula | C23H19NO6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (5-methyl-2-oxochromen-7-yl) 2-[(1R,2S,6R,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetate |
| SMILES | Cc1cc(OC(=O)CN2C(=O)[C@@H]3[C@@H]4C=C[C@H]([C@H]5C[C@H]45)[C@@H]3C2=O)cc2oc(=O)ccc12 |
| InChI | InChI=1S/C23H19NO6/c1-10-6-11(7-17-12(10)4-5-18(25)30-17)29-19(26)9-24-22(27)20-13-2-3-14(16-8-15(13)16)21(20)23(24)28/h2-7,13-16,20-21H,8-9H2,1H3/t13-,14-,15-,16-,20-,21+/m1/s1 |
| InChIKey | RGOVRFMRTVUKNG-FFUSXRSHSA-N |
| XLogP | 2.06 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|