C25H36N4O2 — CID 98153440
1-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]-3-[3-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methylcarbamoylamino]-4-methylphenyl]urea (PubChem CID 98153440) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]-3-[3-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methylcarbamoylamino]-4-methylphenyl]urea.
| Compound Name | 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]-3-[3-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methylcarbamoylamino]-4-methylphenyl]urea |
|---|---|
| PubChem CID | 98153440 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]-3-[3-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methylcarbamoylamino]-4-methylphenyl]urea |
| SMILES | Cc1ccc(NC(=O)NC[C@@H]2C[C@@H]3CC[C@@H]2C3)cc1NC(=O)NC[C@@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C25H36N4O2/c1-15-2-7-22(28-24(30)26-13-20-10-16-3-5-18(20)8-16)12-23(15)29-25(31)27-14-21-11-17-4-6-19(21)9-17/h2,7,12,16-21H,3-6,8-11,13-14H2,1H3,(H2,26,28,30)(H2,27,29,31)/t16-,17+,18-,19-,20+,21+/m1/s1 |
| InChIKey | FCHPHCIYHHHYAK-ZPLOVTKXSA-N |
| XLogP | 5.11 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |