C31H40N4O2 — CID 98153955
1-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]-3-[4-[[4-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methylcarbamoylamino]phenyl]methyl]phenyl]urea (PubChem CID 98153955) has the molecular formula C31H40N4O2 and a molecular weight of 500.69 g/mol. Its IUPAC name is 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]-3-[4-[[4-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methylcarbamoylamino]phenyl]methyl]phenyl]urea.
| Compound Name | 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]-3-[4-[[4-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methylcarbamoylamino]phenyl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 98153955 |
| Molecular Formula | C31H40N4O2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]-3-[4-[[4-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methylcarbamoylamino]phenyl]methyl]phenyl]urea |
| SMILES | O=C(NC[C@@H]1C[C@@H]2CC[C@@H]1C2)Nc1ccc(Cc2ccc(NC(=O)NC[C@@H]3C[C@@H]4CC[C@@H]3C4)cc2)cc1 |
| InChI | InChI=1S/C31H40N4O2/c36-30(32-18-26-16-22-1-7-24(26)14-22)34-28-9-3-20(4-10-28)13-21-5-11-29(12-6-21)35-31(37)33-19-27-17-23-2-8-25(27)15-23/h3-6,9-12,22-27H,1-2,7-8,13-19H2,(H2,32,34,36)(H2,33,35,37)/t22-,23-,24-,25-,26+,27+/m1/s1 |
| InChIKey | SUQJRKPTMFBZRG-QJCWEMJFSA-N |
| XLogP | 6.39 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |