C14H15N5OS — CID 98156294
(NE)-N-[(1S,3R,4S)-3-(1-phenyltetrazol-5-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 98156294) has the molecular formula C14H15N5OS and a molecular weight of 301.38 g/mol. Its IUPAC name is (NE)-N-[(1S,3R,4S)-3-(1-phenyltetrazol-5-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1S,3R,4S)-3-(1-phenyltetrazol-5-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 98156294 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (NE)-N-[(1S,3R,4S)-3-(1-phenyltetrazol-5-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | O/N=C1\[C@H]2CC[C@@H](C2)[C@H]1Sc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C14H15N5OS/c20-16-12-9-6-7-10(8-9)13(12)21-14-15-17-18-19(14)11-4-2-1-3-5-11/h1-5,9-10,13,20H,6-8H2/b16-12+/t9-,10-,13+/m0/s1 |
| InChIKey | FUCFEBMZPXQBHJ-SVKNUGRGSA-N |
| XLogP | 2.38 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|