C24H17NO3 — CID 981585
N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide (PubChem CID 981585) has the molecular formula C24H17NO3 and a molecular weight of 367.40 g/mol. Its IUPAC name is N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide.
| Compound Name | N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide |
|---|---|
| PubChem CID | 981585 |
| Molecular Formula | C24H17NO3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide |
| SMILES | O=C(Nc1c(-c2ccccc2)oc(-c2ccccc2)cc1=O)c1ccccc1 |
| InChI | InChI=1S/C24H17NO3/c26-20-16-21(17-10-4-1-5-11-17)28-23(18-12-6-2-7-13-18)22(20)25-24(27)19-14-8-3-9-15-19/h1-16H,(H,25,27) |
| InChIKey | YANLZTLHRMGDEZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |