About N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide
N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide (PubChem CID 981585) has the molecular formula C24H17NO3
and a molecular weight of 367.40 g/mol. Its IUPAC name is N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide.
Molecular Properties
| Compound Name | N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide |
| PubChem CID | 981585 |
| Molecular Formula | C24H17NO3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide |
| SMILES | O=C(Nc1c(-c2ccccc2)oc(-c2ccccc2)cc1=O)c1ccccc1 |
| InChI | InChI=1S/C24H17NO3/c26-20-16-21(17-10-4-1-5-11-17)28-23(18-12-6-2-7-13-18)22(20)25-24(27)19-14-8-3-9-15-19/h1-16H,(H,25,27) |
| InChIKey | YANLZTLHRMGDEZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide?
The IUPAC name of N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide (CID 981585) is N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide.
What is the SMILES notation for N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide?
The canonical SMILES for N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide is O=C(Nc1c(-c2ccccc2)oc(-c2ccccc2)cc1=O)c1ccccc1.
What is the InChIKey of N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide?
The InChIKey is YANLZTLHRMGDEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17NO3/c26-20-16-21(17-10-4-1-5-11-17)28-23(18-12-6-2-7-13-18)22(20)25-24(27)19-14-8-3-9-15-19/h1-16H,(H,25,27).
What are the key properties of N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide?
N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide has a molecular weight of 367.40 g/mol, XLogP of 5.23, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-oxo-2,6-diphenylpyran-3-yl)benzamide is sourced from PubChem (CID 981585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).