C19H14FNO3 — CID 22750630
6-(4-fluorophenyl)-N-methyl-4-oxo-2-phenylpyran-3-carboxamide (PubChem CID 22750630) has the molecular formula C19H14FNO3 and a molecular weight of 323.32 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-N-methyl-4-oxo-2-phenylpyran-3-carboxamide.
| Compound Name | 6-(4-fluorophenyl)-N-methyl-4-oxo-2-phenylpyran-3-carboxamide |
|---|---|
| PubChem CID | 22750630 |
| Molecular Formula | C19H14FNO3 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 6-(4-fluorophenyl)-N-methyl-4-oxo-2-phenylpyran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccccc2)oc(-c2ccc(F)cc2)cc1=O |
| InChI | InChI=1S/C19H14FNO3/c1-21-19(23)17-15(22)11-16(12-7-9-14(20)10-8-12)24-18(17)13-5-3-2-4-6-13/h2-11H,1H3,(H,21,23) |
| InChIKey | LBHRWTFCFJZFIT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |