C25H20BrF3N4O2S — CID 98159375
(6R)-10-bromo-3-butylsulfanyl-6-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 98159375) has the molecular formula C25H20BrF3N4O2S and a molecular weight of 577.43 g/mol. Its IUPAC name is (6R)-10-bromo-3-butylsulfanyl-6-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | (6R)-10-bromo-3-butylsulfanyl-6-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 98159375 |
| Molecular Formula | C25H20BrF3N4O2S |
| Molecular Weight | 577.43 g/mol |
| Exact Mass | 576.04 |
| IUPAC Name | (6R)-10-bromo-3-butylsulfanyl-6-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CCCCSc1nnc2c(n1)O[C@H](c1ccc(-c3cccc(C(F)(F)F)c3)o1)Nc1ccc(Br)cc1-2 |
| InChI | InChI=1S/C25H20BrF3N4O2S/c1-2-3-11-36-24-31-23-21(32-33-24)17-13-16(26)7-8-18(17)30-22(35-23)20-10-9-19(34-20)14-5-4-6-15(12-14)25(27,28)29/h4-10,12-13,22,30H,2-3,11H2,1H3/t22-/m1/s1 |
| InChIKey | OCWFRIDTILAZEM-JOCHJYFZSA-N |
| XLogP | 7.98 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.43 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|