C22H22BrClN4O3S — CID 98159376
(6S)-10-bromo-3-butylsulfanyl-6-(3-chloro-4,5-dimethoxyphenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 98159376) has the molecular formula C22H22BrClN4O3S and a molecular weight of 537.87 g/mol. Its IUPAC name is (6S)-10-bromo-3-butylsulfanyl-6-(3-chloro-4,5-dimethoxyphenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | (6S)-10-bromo-3-butylsulfanyl-6-(3-chloro-4,5-dimethoxyphenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 98159376 |
| Molecular Formula | C22H22BrClN4O3S |
| Molecular Weight | 537.87 g/mol |
| Exact Mass | 536.03 |
| IUPAC Name | (6S)-10-bromo-3-butylsulfanyl-6-(3-chloro-4,5-dimethoxyphenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CCCCSc1nnc2c(n1)O[C@@H](c1cc(Cl)c(OC)c(OC)c1)Nc1ccc(Br)cc1-2 |
| InChI | InChI=1S/C22H22BrClN4O3S/c1-4-5-8-32-22-26-21-18(27-28-22)14-11-13(23)6-7-16(14)25-20(31-21)12-9-15(24)19(30-3)17(10-12)29-2/h6-7,9-11,20,25H,4-5,8H2,1-3H3/t20-/m0/s1 |
| InChIKey | FJVMPTZCRIFWFD-FQEVSTJZSA-N |
| XLogP | 6.37 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.87 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|