C7H13NO3S — CID 98168048
(1R,7R)-3-methylsulfonyl-8-oxa-3-azabicyclo[5.1.0]octane (PubChem CID 98168048) has the molecular formula C7H13NO3S and a molecular weight of 191.25 g/mol. Its IUPAC name is (1R,7R)-3-methylsulfonyl-8-oxa-3-azabicyclo[5.1.0]octane.
| Compound Name | (1R,7R)-3-methylsulfonyl-8-oxa-3-azabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 98168048 |
| Molecular Formula | C7H13NO3S |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | (1R,7R)-3-methylsulfonyl-8-oxa-3-azabicyclo[5.1.0]octane |
| SMILES | CS(=O)(=O)N1CCC[C@H]2O[C@@H]2C1 |
| InChI | InChI=1S/C7H13NO3S/c1-12(9,10)8-4-2-3-6-7(5-8)11-6/h6-7H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | WMRFIYQQORWQAJ-RNFRBKRXSA-N |
| XLogP | -0.19 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|