C7H12BrNO3S — CID 98168050
(1R,7R)-3-(bromomethylsulfonyl)-8-oxa-3-azabicyclo[5.1.0]octane (PubChem CID 98168050) has the molecular formula C7H12BrNO3S and a molecular weight of 270.15 g/mol. Its IUPAC name is (1R,7R)-3-(bromomethylsulfonyl)-8-oxa-3-azabicyclo[5.1.0]octane.
| Compound Name | (1R,7R)-3-(bromomethylsulfonyl)-8-oxa-3-azabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 98168050 |
| Molecular Formula | C7H12BrNO3S |
| Molecular Weight | 270.15 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | (1R,7R)-3-(bromomethylsulfonyl)-8-oxa-3-azabicyclo[5.1.0]octane |
| SMILES | O=S(=O)(CBr)N1CCC[C@H]2O[C@@H]2C1 |
| InChI | InChI=1S/C7H12BrNO3S/c8-5-13(10,11)9-3-1-2-6-7(4-9)12-6/h6-7H,1-5H2/t6-,7-/m1/s1 |
| InChIKey | VDJMPLQONJOUDS-RNFRBKRXSA-N |
| XLogP | 0.53 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.15 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|