C17H18N2O4 — CID 98185529
(2S)-2-cyano-3-[(3S)-7-methoxy-3,4-dihydro-2H-chromen-3-yl]-3-oxo-N-prop-2-enylpropanamide (PubChem CID 98185529) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is (2S)-2-cyano-3-[(3S)-7-methoxy-3,4-dihydro-2H-chromen-3-yl]-3-oxo-N-prop-2-enylpropanamide.
| Compound Name | (2S)-2-cyano-3-[(3S)-7-methoxy-3,4-dihydro-2H-chromen-3-yl]-3-oxo-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 98185529 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (2S)-2-cyano-3-[(3S)-7-methoxy-3,4-dihydro-2H-chromen-3-yl]-3-oxo-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)[C@@H](C#N)C(=O)[C@@H]1COc2cc(OC)ccc2C1 |
| InChI | InChI=1S/C17H18N2O4/c1-3-6-19-17(21)14(9-18)16(20)12-7-11-4-5-13(22-2)8-15(11)23-10-12/h3-5,8,12,14H,1,6-7,10H2,2H3,(H,19,21)/t12-,14-/m0/s1 |
| InChIKey | YTGLKJUBWXIDDW-JSGCOSHPSA-N |
| XLogP | 1.26 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|