C22H20N4O2 — CID 981859
1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-naphthalen-1-ylurea (PubChem CID 981859) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-naphthalen-1-ylurea.
| Compound Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 981859 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-naphthalen-1-ylurea |
| SMILES | Cc1c(NC(=O)Nc2cccc3ccccc23)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C22H20N4O2/c1-15-20(21(27)26(25(15)2)17-11-4-3-5-12-17)24-22(28)23-19-14-8-10-16-9-6-7-13-18(16)19/h3-14H,1-2H3,(H2,23,24,28) |
| InChIKey | VQYYKXAEOHULMA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |