C19H22N2O5S2 — CID 98185956
(2S)-2-[(1S,2R,9R,10R,11S,12R,16S)-9-ethyl-9-methyl-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid (PubChem CID 98185956) has the molecular formula C19H22N2O5S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is (2S)-2-[(1S,2R,9R,10R,11S,12R,16S)-9-ethyl-9-methyl-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid.
| Compound Name | (2S)-2-[(1S,2R,9R,10R,11S,12R,16S)-9-ethyl-9-methyl-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
|---|---|
| PubChem CID | 98185956 |
| Molecular Formula | C19H22N2O5S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | (2S)-2-[(1S,2R,9R,10R,11S,12R,16S)-9-ethyl-9-methyl-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
| SMILES | CC[C@@]1(C)c2sc(=O)[nH]c2S[C@@H]2[C@H]3C[C@@H]([C@H]4C(=O)N([C@@H](C)C(=O)O)C(=O)[C@H]34)[C@@H]21 |
| InChI | InChI=1S/C19H22N2O5S2/c1-4-19(3)11-7-5-8(12(11)27-14-13(19)28-18(26)20-14)10-9(7)15(22)21(16(10)23)6(2)17(24)25/h6-12H,4-5H2,1-3H3,(H,20,26)(H,24,25)/t6-,7-,8-,9+,10+,11-,12+,19+/m0/s1 |
| InChIKey | ODSRPHMFQGHMHT-GOUUYIDLSA-N |
| XLogP | 1.92 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|