C22H27N3O5S2 — CID 43843951
9-ethyl-9-methyl-14-(2-morpholin-4-yl-2-oxoethyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 43843951) has the molecular formula C22H27N3O5S2 and a molecular weight of 477.61 g/mol. Its IUPAC name is 9-ethyl-9-methyl-14-(2-morpholin-4-yl-2-oxoethyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | 9-ethyl-9-methyl-14-(2-morpholin-4-yl-2-oxoethyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 43843951 |
| Molecular Formula | C22H27N3O5S2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 9-ethyl-9-methyl-14-(2-morpholin-4-yl-2-oxoethyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | CCC1(C)c2sc(=O)[nH]c2SC2C3CC(C4C(=O)N(CC(=O)N5CCOCC5)C(=O)C34)C21 |
| InChI | InChI=1S/C22H27N3O5S2/c1-3-22(2)15-10-8-11(16(15)31-18-17(22)32-21(29)23-18)14-13(10)19(27)25(20(14)28)9-12(26)24-4-6-30-7-5-24/h10-11,13-16H,3-9H2,1-2H3,(H,23,29) |
| InChIKey | XNRLJPMDYCDMFV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 99.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|