C21H29N3O5S — CID 98188587
1-[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]-2-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)ethanone (PubChem CID 98188587) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is 1-[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]-2-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)ethanone.
| Compound Name | 1-[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]-2-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 98188587 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1-[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]-2-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)N2CC[C@H](N3CC=CC3)C2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H29N3O5S/c1-28-19-5-4-17(14-20(19)30(26,27)24-10-12-29-13-11-24)15-21(25)23-9-6-18(16-23)22-7-2-3-8-22/h2-5,14,18H,6-13,15-16H2,1H3/t18-/m0/s1 |
| InChIKey | YJJBFNUTQJLGGD-SFHVURJKSA-N |
| XLogP | 0.73 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|