C23H23N5O5 — CID 98196980
ethyl 2-[[2-[(3aR,6aS)-5-(3,5-dimethylphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]acetyl]amino]benzoate (PubChem CID 98196980) has the molecular formula C23H23N5O5 and a molecular weight of 449.47 g/mol. Its IUPAC name is ethyl 2-[[2-[(3aR,6aS)-5-(3,5-dimethylphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[(3aR,6aS)-5-(3,5-dimethylphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 98196980 |
| Molecular Formula | C23H23N5O5 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | ethyl 2-[[2-[(3aR,6aS)-5-(3,5-dimethylphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CN1N=N[C@@H]2C(=O)N(c3cc(C)cc(C)c3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C23H23N5O5/c1-4-33-23(32)16-7-5-6-8-17(16)24-18(29)12-27-20-19(25-26-27)21(30)28(22(20)31)15-10-13(2)9-14(3)11-15/h5-11,19-20H,4,12H2,1-3H3,(H,24,29)/t19-,20+/m0/s1 |
| InChIKey | XLOVKIKKBWMGFL-VQTJNVASSA-N |
| XLogP | 2.41 |
| TPSA | 120.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|