C22H23N5O3 — CID 7385852
2-[(3aS,6aR)-5-(3,5-dimethylphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-[(4-methylphenyl)methyl]acetamide (PubChem CID 7385852) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-(3,5-dimethylphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-[(4-methylphenyl)methyl]acetamide.
| Compound Name | 2-[(3aS,6aR)-5-(3,5-dimethylphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-[(4-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 7385852 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 2-[(3aS,6aR)-5-(3,5-dimethylphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-[(4-methylphenyl)methyl]acetamide |
| SMILES | Cc1ccc(CNC(=O)CN2N=N[C@H]3C(=O)N(c4cc(C)cc(C)c4)C(=O)[C@H]32)cc1 |
| InChI | InChI=1S/C22H23N5O3/c1-13-4-6-16(7-5-13)11-23-18(28)12-26-20-19(24-25-26)21(29)27(22(20)30)17-9-14(2)8-15(3)10-17/h4-10,19-20H,11-12H2,1-3H3,(H,23,28)/t19-,20+/m1/s1 |
| InChIKey | ZAEVOYHFMFTLEO-UXHICEINSA-N |
| XLogP | 2.22 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|