C23H30N4O5S — CID 98201302
3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]propanamide (PubChem CID 98201302) has the molecular formula C23H30N4O5S and a molecular weight of 474.58 g/mol. Its IUPAC name is 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 98201302 |
| Molecular Formula | C23H30N4O5S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]propanamide |
| SMILES | O=C(CCN1C(=O)[C@@H]2CCCC[C@H]2C1=O)Nc1ccc(S(=O)(=O)NC2=NCCCCC2)cc1 |
| InChI | InChI=1S/C23H30N4O5S/c28-21(13-15-27-22(29)18-6-3-4-7-19(18)23(27)30)25-16-9-11-17(12-10-16)33(31,32)26-20-8-2-1-5-14-24-20/h9-12,18-19H,1-8,13-15H2,(H,24,26)(H,25,28)/t18-,19-/m1/s1 |
| InChIKey | BWYDQVGSLYBGIR-RTBURBONSA-N |
| XLogP | 2.44 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|