C20H29N3O5S — CID 55754538
3-(oxolan-2-ylmethoxy)-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]propanamide (PubChem CID 55754538) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethoxy)-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-(oxolan-2-ylmethoxy)-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 55754538 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-(oxolan-2-ylmethoxy)-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]propanamide |
| SMILES | O=C(CCOCC1CCCO1)Nc1ccc(S(=O)(=O)NC2=NCCCCC2)cc1 |
| InChI | InChI=1S/C20H29N3O5S/c24-20(11-14-27-15-17-5-4-13-28-17)22-16-7-9-18(10-8-16)29(25,26)23-19-6-2-1-3-12-21-19/h7-10,17H,1-6,11-15H2,(H,21,23)(H,22,24) |
| InChIKey | OFNCJWKTRUOWBB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|