C17H23N3O3S — CID 98210345
(2S)-2-cyano-3-[(4R)-3-(cyclobutanecarbonyl)-1,3-thiazolidin-4-yl]-N-cyclopentyl-3-oxopropanamide (PubChem CID 98210345) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is (2S)-2-cyano-3-[(4R)-3-(cyclobutanecarbonyl)-1,3-thiazolidin-4-yl]-N-cyclopentyl-3-oxopropanamide.
| Compound Name | (2S)-2-cyano-3-[(4R)-3-(cyclobutanecarbonyl)-1,3-thiazolidin-4-yl]-N-cyclopentyl-3-oxopropanamide |
|---|---|
| PubChem CID | 98210345 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (2S)-2-cyano-3-[(4R)-3-(cyclobutanecarbonyl)-1,3-thiazolidin-4-yl]-N-cyclopentyl-3-oxopropanamide |
| SMILES | N#C[C@H](C(=O)NC1CCCC1)C(=O)[C@@H]1CSCN1C(=O)C1CCC1 |
| InChI | InChI=1S/C17H23N3O3S/c18-8-13(16(22)19-12-6-1-2-7-12)15(21)14-9-24-10-20(14)17(23)11-4-3-5-11/h11-14H,1-7,9-10H2,(H,19,22)/t13-,14-/m0/s1 |
| InChIKey | VVGPANWFFIVKTD-KBPBESRZSA-N |
| XLogP | 1.46 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|