C15H23N3O4S — CID 98765344
(2S)-2-cyano-N-cyclopentyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-3-oxopropanamide (PubChem CID 98765344) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is (2S)-2-cyano-N-cyclopentyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-3-oxopropanamide.
| Compound Name | (2S)-2-cyano-N-cyclopentyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-3-oxopropanamide |
|---|---|
| PubChem CID | 98765344 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2S)-2-cyano-N-cyclopentyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-3-oxopropanamide |
| SMILES | CS(=O)(=O)N1CCC[C@H](C(=O)[C@H](C#N)C(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C15H23N3O4S/c1-23(21,22)18-8-4-5-11(10-18)14(19)13(9-16)15(20)17-12-6-2-3-7-12/h11-13H,2-8,10H2,1H3,(H,17,20)/t11-,13-/m0/s1 |
| InChIKey | UCFSPIVXBHVQHB-AAEUAGOBSA-N |
| XLogP | 0.43 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|