C19H14F4N2O4 — CID 98210814
2-[(3R)-3-(2-fluorophenyl)-2,5-dioxopyrrolidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 98210814) has the molecular formula C19H14F4N2O4 and a molecular weight of 410.32 g/mol. Its IUPAC name is 2-[(3R)-3-(2-fluorophenyl)-2,5-dioxopyrrolidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[(3R)-3-(2-fluorophenyl)-2,5-dioxopyrrolidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 98210814 |
| Molecular Formula | C19H14F4N2O4 |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 2-[(3R)-3-(2-fluorophenyl)-2,5-dioxopyrrolidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)C[C@H](c2ccccc2F)C1=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14F4N2O4/c20-15-4-2-1-3-13(15)14-9-17(27)25(18(14)28)10-16(26)24-11-5-7-12(8-6-11)29-19(21,22)23/h1-8,14H,9-10H2,(H,24,26)/t14-/m1/s1 |
| InChIKey | OZOSXDMZZAHMAH-CQSZACIVSA-N |
| XLogP | 3.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|