C27H54O7S2 — CID 98213875
[(2S)-1-hexylsulfonyl-3-(2-hexylsulfonylethoxy)propan-2-yl] decanoate (PubChem CID 98213875) has the molecular formula C27H54O7S2 and a molecular weight of 554.86 g/mol. Its IUPAC name is [(2S)-1-hexylsulfonyl-3-(2-hexylsulfonylethoxy)propan-2-yl] decanoate.
| Compound Name | [(2S)-1-hexylsulfonyl-3-(2-hexylsulfonylethoxy)propan-2-yl] decanoate |
|---|---|
| PubChem CID | 98213875 |
| Molecular Formula | C27H54O7S2 |
| Molecular Weight | 554.86 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | [(2S)-1-hexylsulfonyl-3-(2-hexylsulfonylethoxy)propan-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)O[C@@H](COCCS(=O)(=O)CCCCCC)CS(=O)(=O)CCCCCC |
| InChI | InChI=1S/C27H54O7S2/c1-4-7-10-13-14-15-16-19-27(28)34-26(25-36(31,32)22-18-12-9-6-3)24-33-20-23-35(29,30)21-17-11-8-5-2/h26H,4-25H2,1-3H3/t26-/m0/s1 |
| InChIKey | KYPWSUDTICKANV-SANMLTNESA-N |
| XLogP | 6.05 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.86 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|