C21H17Cl2NO2 — CID 98214048
(1R,2S,6S,7R,8R)-4-(2,5-dichlorophenyl)-8-phenyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 98214048) has the molecular formula C21H17Cl2NO2 and a molecular weight of 386.28 g/mol. Its IUPAC name is (1R,2S,6S,7R,8R)-4-(2,5-dichlorophenyl)-8-phenyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6S,7R,8R)-4-(2,5-dichlorophenyl)-8-phenyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 98214048 |
| Molecular Formula | C21H17Cl2NO2 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | (1R,2S,6S,7R,8R)-4-(2,5-dichlorophenyl)-8-phenyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1[C@H]2[C@@H]3C[C@@H]([C@@H]2C(=O)N1c1cc(Cl)ccc1Cl)[C@H](c1ccccc1)C3 |
| InChI | InChI=1S/C21H17Cl2NO2/c22-13-6-7-16(23)17(10-13)24-20(25)18-12-8-14(11-4-2-1-3-5-11)15(9-12)19(18)21(24)26/h1-7,10,12,14-15,18-19H,8-9H2/t12-,14-,15+,18-,19-/m0/s1 |
| InChIKey | BTIQDACSUXCHFU-DYOXLCOFSA-N |
| XLogP | 4.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|