C20H25FN2O — CID 98220392
[4-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]piperidin-1-yl]-(2-fluorophenyl)methanone (PubChem CID 98220392) has the molecular formula C20H25FN2O and a molecular weight of 328.43 g/mol. Its IUPAC name is [4-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]piperidin-1-yl]-(2-fluorophenyl)methanone.
| Compound Name | [4-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]piperidin-1-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 98220392 |
| Molecular Formula | C20H25FN2O |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | [4-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]piperidin-1-yl]-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)N1CCC(NC[C@@H]2C[C@H]3C=C[C@H]2C3)CC1 |
| InChI | InChI=1S/C20H25FN2O/c21-19-4-2-1-3-18(19)20(24)23-9-7-17(8-10-23)22-13-16-12-14-5-6-15(16)11-14/h1-6,14-17,22H,7-13H2/t14-,15-,16-/m0/s1 |
| InChIKey | HXKMNEBTLISIDP-JYJNAYRXSA-N |
| XLogP | 3.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|