C22H25FN2O — CID 119108021
(2-fluorophenyl)-[4-[[(Z)-2-methyl-3-phenylprop-2-enyl]amino]piperidin-1-yl]methanone (PubChem CID 119108021) has the molecular formula C22H25FN2O and a molecular weight of 352.45 g/mol. Its IUPAC name is (2-fluorophenyl)-[4-[[(Z)-2-methyl-3-phenylprop-2-enyl]amino]piperidin-1-yl]methanone.
| Compound Name | (2-fluorophenyl)-[4-[[(Z)-2-methyl-3-phenylprop-2-enyl]amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119108021 |
| Molecular Formula | C22H25FN2O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (2-fluorophenyl)-[4-[[(Z)-2-methyl-3-phenylprop-2-enyl]amino]piperidin-1-yl]methanone |
| SMILES | C/C(=C/c1ccccc1)CNC1CCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H25FN2O/c1-17(15-18-7-3-2-4-8-18)16-24-19-11-13-25(14-12-19)22(26)20-9-5-6-10-21(20)23/h2-10,15,19,24H,11-14,16H2,1H3/b17-15- |
| InChIKey | IIKYYDSGTKXWHK-ICFOKQHNSA-N |
| XLogP | 4.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |