C21H33N3 — CID 119108400
N-[(E)-2-methyl-3-phenylprop-2-enyl]-1-(1-methylpiperidin-4-yl)piperidin-4-amine (PubChem CID 119108400) has the molecular formula C21H33N3 and a molecular weight of 327.52 g/mol. Its IUPAC name is N-[(E)-2-methyl-3-phenylprop-2-enyl]-1-(1-methylpiperidin-4-yl)piperidin-4-amine.
| Compound Name | N-[(E)-2-methyl-3-phenylprop-2-enyl]-1-(1-methylpiperidin-4-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 119108400 |
| Molecular Formula | C21H33N3 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.27 |
| IUPAC Name | N-[(E)-2-methyl-3-phenylprop-2-enyl]-1-(1-methylpiperidin-4-yl)piperidin-4-amine |
| SMILES | C/C(=C\c1ccccc1)CNC1CCN(C2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C21H33N3/c1-18(16-19-6-4-3-5-7-19)17-22-20-8-14-24(15-9-20)21-10-12-23(2)13-11-21/h3-7,16,20-22H,8-15,17H2,1-2H3/b18-16+ |
| InChIKey | IESUULKFSTUMIQ-FBMGVBCBSA-N |
| XLogP | 3.24 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |