C31H30FN3O3S — CID 98220846
ethyl 2-[4-[[(7S)-7-(3-fluorophenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]phenyl]acetate (PubChem CID 98220846) has the molecular formula C31H30FN3O3S and a molecular weight of 543.66 g/mol. Its IUPAC name is ethyl 2-[4-[[(7S)-7-(3-fluorophenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[[(7S)-7-(3-fluorophenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 98220846 |
| Molecular Formula | C31H30FN3O3S |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | ethyl 2-[4-[[(7S)-7-(3-fluorophenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NC(=O)N2Cc3c(sc4c3CCCC4)-n3cccc3[C@@H]2c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C31H30FN3O3S/c1-2-38-28(36)17-20-12-14-23(15-13-20)33-31(37)35-19-25-24-9-3-4-11-27(24)39-30(25)34-16-6-10-26(34)29(35)21-7-5-8-22(32)18-21/h5-8,10,12-16,18,29H,2-4,9,11,17,19H2,1H3,(H,33,37)/t29-/m0/s1 |
| InChIKey | XSBPPQGJORTUEP-LJAQVGFWSA-N |
| XLogP | 6.80 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |