C17H16N2O5 — CID 98221866
N-[(3aR,4R,7R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(3-methylphenoxy)acetamide (PubChem CID 98221866) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is N-[(3aR,4R,7R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(3-methylphenoxy)acetamide.
| Compound Name | N-[(3aR,4R,7R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 98221866 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-[(3aR,4R,7R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(3-methylphenoxy)acetamide |
| SMILES | Cc1cccc(OCC(=O)NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3O2)c1 |
| InChI | InChI=1S/C17H16N2O5/c1-9-3-2-4-10(7-9)23-8-13(20)18-19-16(21)14-11-5-6-12(24-11)15(14)17(19)22/h2-7,11-12,14-15H,8H2,1H3,(H,18,20)/t11-,12-,14-,15+/m1/s1 |
| InChIKey | ARPUQGRHGQAJPR-GBOPCIDUSA-N |
| XLogP | 0.34 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|