C26H26F3N3O5 — CID 98228058
(3aR,7aR)-2-[4-[4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-3-nitrophenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 98228058) has the molecular formula C26H26F3N3O5 and a molecular weight of 517.50 g/mol. Its IUPAC name is (3aR,7aR)-2-[4-[4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-3-nitrophenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[4-[4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-3-nitrophenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 98228058 |
| Molecular Formula | C26H26F3N3O5 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | (3aR,7aR)-2-[4-[4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-3-nitrophenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2CCCC[C@H]2C(=O)N1c1ccc(N2CCC(O)(c3cccc(C(F)(F)F)c3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H26F3N3O5/c27-26(28,29)17-5-3-4-16(14-17)25(35)10-12-30(13-11-25)21-9-8-18(15-22(21)32(36)37)31-23(33)19-6-1-2-7-20(19)24(31)34/h3-5,8-9,14-15,19-20,35H,1-2,6-7,10-13H2/t19-,20-/m1/s1 |
| InChIKey | IJAXLKBGYKOEPA-WOJBJXKFSA-N |
| XLogP | 4.78 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|