C28H16Cl3F3N2O3 — CID 98231059
(1R,11S,12R,16S)-14-[4-chloro-3-(trifluoromethyl)phenyl]-11-(2,4-dichlorobenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 98231059) has the molecular formula C28H16Cl3F3N2O3 and a molecular weight of 591.80 g/mol. Its IUPAC name is (1R,11S,12R,16S)-14-[4-chloro-3-(trifluoromethyl)phenyl]-11-(2,4-dichlorobenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1R,11S,12R,16S)-14-[4-chloro-3-(trifluoromethyl)phenyl]-11-(2,4-dichlorobenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 98231059 |
| Molecular Formula | C28H16Cl3F3N2O3 |
| Molecular Weight | 591.80 g/mol |
| Exact Mass | 590.02 |
| IUPAC Name | (1R,11S,12R,16S)-14-[4-chloro-3-(trifluoromethyl)phenyl]-11-(2,4-dichlorobenzoyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1ccc(Cl)cc1Cl)[C@@H]1[C@@H]2C(=O)N(c3ccc(Cl)c(C(F)(F)F)c3)C(=O)[C@@H]2[C@@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C28H16Cl3F3N2O3/c29-14-5-7-17(20(31)11-14)25(37)24-22-21(23-16-4-2-1-3-13(16)9-10-35(23)24)26(38)36(27(22)39)15-6-8-19(30)18(12-15)28(32,33)34/h1-12,21-24H/t21-,22+,23-,24-/m0/s1 |
| InChIKey | CNOAFCNKVBUKIE-KIHHCIJBSA-N |
| XLogP | 7.06 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.80 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|