C27H18Cl2N2O3 — CID 3325201
11-(2,4-dichlorobenzoyl)-14-phenyl-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 3325201) has the molecular formula C27H18Cl2N2O3 and a molecular weight of 489.36 g/mol. Its IUPAC name is 11-(2,4-dichlorobenzoyl)-14-phenyl-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | 11-(2,4-dichlorobenzoyl)-14-phenyl-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 3325201 |
| Molecular Formula | C27H18Cl2N2O3 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 11-(2,4-dichlorobenzoyl)-14-phenyl-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1ccc(Cl)cc1Cl)C1C2C(=O)N(c3ccccc3)C(=O)C2C2c3ccccc3C=CN12 |
| InChI | InChI=1S/C27H18Cl2N2O3/c28-16-10-11-19(20(29)14-16)25(32)24-22-21(23-18-9-5-4-6-15(18)12-13-30(23)24)26(33)31(27(22)34)17-7-2-1-3-8-17/h1-14,21-24H |
| InChIKey | VNJHCJMWQXBDRG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|