C17H18N2O3 — CID 98232509
3-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-(furan-2-ylmethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 98232509) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-(furan-2-ylmethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-(furan-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 98232509 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-(furan-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCc2ccco2)c(NC[C@H]2C[C@@H]3C=C[C@H]2C3)c1=O |
| InChI | InChI=1S/C17H18N2O3/c20-16-14(18-8-12-7-10-3-4-11(12)6-10)15(17(16)21)19-9-13-2-1-5-22-13/h1-5,10-12,18-19H,6-9H2/t10-,11+,12-/m1/s1 |
| InChIKey | KMEDUEMGEXSFII-GRYCIOLGSA-N |
| XLogP | 2.11 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|