C25H26N4O2 — CID 98246244
2-(4-ethylphenyl)-8-[(3R)-3-methylpiperidine-1-carbonyl]-1H-pyrazolo[4,3-c]quinolin-3-one (PubChem CID 98246244) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-8-[(3R)-3-methylpiperidine-1-carbonyl]-1H-pyrazolo[4,3-c]quinolin-3-one.
| Compound Name | 2-(4-ethylphenyl)-8-[(3R)-3-methylpiperidine-1-carbonyl]-1H-pyrazolo[4,3-c]quinolin-3-one |
|---|---|
| PubChem CID | 98246244 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 2-(4-ethylphenyl)-8-[(3R)-3-methylpiperidine-1-carbonyl]-1H-pyrazolo[4,3-c]quinolin-3-one |
| SMILES | CCc1ccc(-n2[nH]c3c(cnc4ccc(C(=O)N5CCC[C@@H](C)C5)cc43)c2=O)cc1 |
| InChI | InChI=1S/C25H26N4O2/c1-3-17-6-9-19(10-7-17)29-25(31)21-14-26-22-11-8-18(13-20(22)23(21)27-29)24(30)28-12-4-5-16(2)15-28/h6-11,13-14,16,27H,3-5,12,15H2,1-2H3/t16-/m1/s1 |
| InChIKey | RLSQXXVLBYSXSS-MRXNPFEDSA-N |
| XLogP | 4.30 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|