C24H24N4O2 — CID 53132467
8-(2-ethylpiperidine-1-carbonyl)-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one (PubChem CID 53132467) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 8-(2-ethylpiperidine-1-carbonyl)-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one.
| Compound Name | 8-(2-ethylpiperidine-1-carbonyl)-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one |
|---|---|
| PubChem CID | 53132467 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 8-(2-ethylpiperidine-1-carbonyl)-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one |
| SMILES | CCC1CCCCN1C(=O)c1ccc2ncc3c(=O)n(-c4ccccc4)[nH]c3c2c1 |
| InChI | InChI=1S/C24H24N4O2/c1-2-17-8-6-7-13-27(17)23(29)16-11-12-21-19(14-16)22-20(15-25-21)24(30)28(26-22)18-9-4-3-5-10-18/h3-5,9-12,14-15,17,26H,2,6-8,13H2,1H3 |
| InChIKey | RJDOMYIBKIGEQZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|