About (4S)-1,3-dimethyl-5-oxo-N-(2-piperidin-1-ylphenyl)-4H-pyrazole-4-carboxamide
(4S)-1,3-dimethyl-5-oxo-N-(2-piperidin-1-ylphenyl)-4H-pyrazole-4-carboxamide (PubChem CID 98258864) has the molecular formula C17H22N4O2
and a molecular weight of 314.39 g/mol. Its IUPAC name is (4S)-1,3-dimethyl-5-oxo-N-(2-piperidin-1-ylphenyl)-4H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | (4S)-1,3-dimethyl-5-oxo-N-(2-piperidin-1-ylphenyl)-4H-pyrazole-4-carboxamide |
| PubChem CID | 98258864 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (4S)-1,3-dimethyl-5-oxo-N-(2-piperidin-1-ylphenyl)-4H-pyrazole-4-carboxamide |
| SMILES | CC1=NN(C)C(=O)[C@@H]1C(=O)Nc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C17H22N4O2/c1-12-15(17(23)20(2)19-12)16(22)18-13-8-4-5-9-14(13)21-10-6-3-7-11-21/h4-5,8-9,15H,3,6-7,10-11H2,1-2H3,(H,18,22)/t15-/m0/s1 |
| InChIKey | GJAYTBMADQTBCH-HNNXBMFYSA-N |
| XLogP | 2.08 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (4S)-1,3-dimethyl-5-oxo-N-(2-piperidin-1-ylphenyl)-4H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1,3-dimethyl-5-oxo-N-(2-piperidin-1-ylphenyl)-4H-pyrazole-4-carboxamide?
The IUPAC name of (4S)-1,3-dimethyl-5-oxo-N-(2-piperidin-1-ylphenyl)-4H-pyrazole-4-carboxamide (CID 98258864) is (4S)-1,3-dimethyl-5-oxo-N-(2-piperidin-1-ylphenyl)-4H-pyrazole-4-carboxamide.
What is the SMILES notation for (4S)-1,3-dimethyl-5-oxo-N-(2-piperidin-1-ylphenyl)-4H-pyrazole-4-carboxamide?
The canonical SMILES for (4S)-1,3-dimethyl-5-oxo-N-(2-piperidin-1-ylphenyl)-4H-pyrazole-4-carboxamide is CC1=NN(C)C(=O)[C@@H]1C(=O)Nc1ccccc1N1CCCCC1.
What is the InChIKey of (4S)-1,3-dimethyl-5-oxo-N-(2-piperidin-1-ylphenyl)-4H-pyrazole-4-carboxamide?
The InChIKey is GJAYTBMADQTBCH-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H22N4O2/c1-12-15(17(23)20(2)19-12)16(22)18-13-8-4-5-9-14(13)21-10-6-3-7-11-21/h4-5,8-9,15H,3,6-7,10-11H2,1-2H3,(H,18,22)/t15-/m0/s1.
What are the key properties of (4S)-1,3-dimethyl-5-oxo-N-(2-piperidin-1-ylphenyl)-4H-pyrazole-4-carboxamide?
(4S)-1,3-dimethyl-5-oxo-N-(2-piperidin-1-ylphenyl)-4H-pyrazole-4-carboxamide has a molecular weight of 314.39 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1,3-dimethyl-5-oxo-N-(2-piperidin-1-ylphenyl)-4H-pyrazole-4-carboxamide is sourced from PubChem (CID 98258864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).