C25H31NO7 — CID 98260353
6-O-methyl 3-O-propan-2-yl (4S,6S,7R)-4-(2,5-dimethoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 98260353) has the molecular formula C25H31NO7 and a molecular weight of 457.52 g/mol. Its IUPAC name is 6-O-methyl 3-O-propan-2-yl (4S,6S,7R)-4-(2,5-dimethoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 6-O-methyl 3-O-propan-2-yl (4S,6S,7R)-4-(2,5-dimethoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 98260353 |
| Molecular Formula | C25H31NO7 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 6-O-methyl 3-O-propan-2-yl (4S,6S,7R)-4-(2,5-dimethoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)C2=C(C[C@H]1C)NC(C)=C(C(=O)OC(C)C)[C@H]2c1cc(OC)ccc1OC |
| InChI | InChI=1S/C25H31NO7/c1-12(2)33-25(29)20-14(4)26-17-10-13(3)19(24(28)32-7)23(27)22(17)21(20)16-11-15(30-5)8-9-18(16)31-6/h8-9,11-13,19,21,26H,10H2,1-7H3/t13-,19+,21-/m1/s1 |
| InChIKey | HUDXMJQZAVOTBN-YIILKADPSA-N |
| XLogP | 3.27 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|