C25H28N4O6 — CID 98260653
4-[2-[(3aS,5R,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethylamino]-N-(2-methoxyphenyl)-3-nitrobenzamide (PubChem CID 98260653) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is 4-[2-[(3aS,5R,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethylamino]-N-(2-methoxyphenyl)-3-nitrobenzamide.
| Compound Name | 4-[2-[(3aS,5R,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethylamino]-N-(2-methoxyphenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 98260653 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 4-[2-[(3aS,5R,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethylamino]-N-(2-methoxyphenyl)-3-nitrobenzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NCCN2C(=O)[C@H]3C[C@H](C)CC[C@H]3C2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H28N4O6/c1-15-7-9-17-18(13-15)25(32)28(24(17)31)12-11-26-19-10-8-16(14-21(19)29(33)34)23(30)27-20-5-3-4-6-22(20)35-2/h3-6,8,10,14-15,17-18,26H,7,9,11-13H2,1-2H3,(H,27,30)/t15-,17-,18+/m1/s1 |
| InChIKey | XGHTXDSANBBAKT-NXHRZFHOSA-N |
| XLogP | 3.69 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|