C29H32N4O6 — CID 98263309
[(4R)-5-ethoxycarbonyl-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidin-6-yl]methyl 3-hexyl-4-oxophthalazine-1-carboxylate (PubChem CID 98263309) has the molecular formula C29H32N4O6 and a molecular weight of 532.60 g/mol. Its IUPAC name is [(4R)-5-ethoxycarbonyl-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidin-6-yl]methyl 3-hexyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [(4R)-5-ethoxycarbonyl-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidin-6-yl]methyl 3-hexyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 98263309 |
| Molecular Formula | C29H32N4O6 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | [(4R)-5-ethoxycarbonyl-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidin-6-yl]methyl 3-hexyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCCCCCn1nc(C(=O)OCC2=C(C(=O)OCC)[C@@H](c3ccccc3)NC(=O)N2)c2ccccc2c1=O |
| InChI | InChI=1S/C29H32N4O6/c1-3-5-6-12-17-33-26(34)21-16-11-10-15-20(21)25(32-33)28(36)39-18-22-23(27(35)38-4-2)24(31-29(37)30-22)19-13-8-7-9-14-19/h7-11,13-16,24H,3-6,12,17-18H2,1-2H3,(H2,30,31,37)/t24-/m1/s1 |
| InChIKey | KAEZUTRLTFPHHG-XMMPIXPASA-N |
| XLogP | 4.00 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|