C23H25N3O2 — CID 98265769
2-[(3aS)-4-oxo-1,2,3,3a-tetrahydrocyclopenta[c][1,5]benzodiazepin-5-yl]-N-(3-phenylpropyl)acetamide (PubChem CID 98265769) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-[(3aS)-4-oxo-1,2,3,3a-tetrahydrocyclopenta[c][1,5]benzodiazepin-5-yl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[(3aS)-4-oxo-1,2,3,3a-tetrahydrocyclopenta[c][1,5]benzodiazepin-5-yl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 98265769 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 2-[(3aS)-4-oxo-1,2,3,3a-tetrahydrocyclopenta[c][1,5]benzodiazepin-5-yl]-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(CN1C(=O)[C@H]2CCCC2=Nc2ccccc21)NCCCc1ccccc1 |
| InChI | InChI=1S/C23H25N3O2/c27-22(24-15-7-10-17-8-2-1-3-9-17)16-26-21-14-5-4-12-20(21)25-19-13-6-11-18(19)23(26)28/h1-5,8-9,12,14,18H,6-7,10-11,13,15-16H2,(H,24,27)/t18-/m0/s1 |
| InChIKey | XFPTVWWRYCUCCY-SFHVURJKSA-N |
| XLogP | 3.65 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|