C34H39N3O2S — CID 98269843
(11S)-N-cyclooctyl-4-ethyl-9-oxo-11-phenyl-10-[(1R)-1-phenylethyl]-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 98269843) has the molecular formula C34H39N3O2S and a molecular weight of 553.77 g/mol. Its IUPAC name is (11S)-N-cyclooctyl-4-ethyl-9-oxo-11-phenyl-10-[(1R)-1-phenylethyl]-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | (11S)-N-cyclooctyl-4-ethyl-9-oxo-11-phenyl-10-[(1R)-1-phenylethyl]-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 98269843 |
| Molecular Formula | C34H39N3O2S |
| Molecular Weight | 553.77 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | (11S)-N-cyclooctyl-4-ethyl-9-oxo-11-phenyl-10-[(1R)-1-phenylethyl]-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | CCc1cc2c(cc3n2C[C@](C(=O)NC2CCCCCCC2)(c2ccccc2)N([C@H](C)c2ccccc2)C3=O)s1 |
| InChI | InChI=1S/C34H39N3O2S/c1-3-28-21-29-31(40-28)22-30-32(38)37(24(2)25-15-9-7-10-16-25)34(23-36(29)30,26-17-11-8-12-18-26)33(39)35-27-19-13-5-4-6-14-20-27/h7-12,15-18,21-22,24,27H,3-6,13-14,19-20,23H2,1-2H3,(H,35,39)/t24-,34-/m1/s1 |
| InChIKey | XLTOTQVPNDHHKU-PBUKZNKTSA-N |
| XLogP | 7.61 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.77 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |